| ID: | BPH | |
|---|---|---|
| Name: | biphenyl | |
| Description: | ||
| Labels: | ||
| CAS: | 92-52-4 | |
| InChi Code: | InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
logS_hept: logarithm of solubility in n-heptane [mol/L]
| Value | Source or prediction |
|---|---|
| 0.2209 |
experimental value |
| -0.1172 |
Eq1: QSPR for solubility in n-heptane (Training set) |
logS_oct: logarithm of solubility in 1-octanol [mol/L]
| Value | Source or prediction |
|---|---|
| -0.1603 |
experimental value |
| -0.1345 |
Eq5: QSPR for solubility in 1-octanol (Training set) |
| Link | Resource description |
|---|---|
| DTXSID4020161 | US EPA CompTox Dashboard |