Bhhatarai, B.; Gramatica, P. Modelling physico-chemical properties of (benzo)triazoles, and screening for environmental partitioning. Water Res. 2011, 45, 3, 1463–1471.
Compound
| ID: | 077314-77-3 | |
|---|---|---|
| Name: | 4-(5-amino-2H-1,2,4-triazol-3-yl)-N-ethylpyridin-2-amine | |
| Description: | InChI code and name were downloaded from http://cactus.nci.nih.gov | |
| Labels: | ||
| CAS: | 77314-77-3 | |
| InChi Code: | InChI=1S/C9H12N6/c1-2-11-7-5-6(3-4-12-7)8-13-9(10)15-14-8/h3-5H,2H2,1H3,(H,11,12)(H3,10,13,14,15) |
Properties
logKow: Octanol/water partition coefficient as logKow
| Value | Source or prediction |
|---|---|
| 1.13 |
experimental value |
| 1.29 |
Eq2: Model for octanol/water partition coefficient (Training set) |