Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 108-08-7 | |
|---|---|---|
| Name: | 2,4-Dimethylpentane | |
| Description: | ||
| Labels: | ||
| CAS: | 108-08-7 | |
| InChi Code: | InChI=1S/C7H16/c1-6(2)5-7(3)4/h6-7H,5H2,1-4H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 353.64 |
experimental value |
| 354.53 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 294.82 |
experimental value |
| 313.35 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID2059358 | US EPA CompTox Dashboard |