Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 116-14-3 | |
|---|---|---|
| Name: | Tetrafluoroethylene | |
| Description: | ||
| Labels: | ||
| CAS: | 116-14-3 | |
| InChi Code: | InChI=1S/C2F4/c3-1(4)2(5)6 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 197.25 |
experimental value |
| 204.91 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 168.546 |
experimental value |
| 199.37 |
Eq13: Model for enthalphy of vaporization (Validation set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID6021325 | US EPA CompTox Dashboard |