Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 137-32-6 | |
|---|---|---|
| Name: | 2-Methyl-1-Butanol | |
| Description: | ||
| Labels: | ||
| CAS: | 137-32-6 | |
| InChi Code: | InChI=1S/C5H12O/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 400.65 |
experimental value |
| 380.04 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 507.508 |
experimental value |
| 437.07 |
Eq13: Model for enthalphy of vaporization (Validation set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID5027069 | US EPA CompTox Dashboard |