Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 25167-88-8 | |
|---|---|---|
| Name: | 1,1-Dichloro-2-fluoroethane | |
| Description: | ||
| Labels: | ||
| CAS: | 25167-88-8 | |
| InChi Code: | InChI=1S/C2H3Cl2F/c3-2(4)1-5/h2H,1H2 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 305 |
experimental value |
| 321.78 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 223.369 |
experimental value |
| 244.81 |
Eq13: Model for enthalphy of vaporization (Training set) |