Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 471-43-2 | |
|---|---|---|
| Name: | 1,1-Dichloro-2,2-difluoroethane | |
| Description: | ||
| Labels: | ||
| CAS: | 471-43-2 | |
| InChi Code: | InChI=1S/C2H2Cl2F2/c3-1(4)2(5)6/h1-2H |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 333.15 |
experimental value |
| 304.38 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 211.064 |
experimental value |
| 220.53 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID2073190 | US EPA CompTox Dashboard |