Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 563-45-1 | |
|---|---|---|
| Name: | 3-Methyl-1-Butene | |
| Description: | ||
| Labels: | ||
| CAS: | 563-45-1 | |
| InChi Code: | InChI=1S/C5H10/c1-4-5(2)3/h4-5H,1H2,2-3H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 293.25 |
experimental value |
| 303.89 |
Eq12: Model for normal boiling point (Validation set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 347.627 |
experimental value |
| 360.08 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID7060336 | US EPA CompTox Dashboard |