| ID: | 565-59-3 | |
|---|---|---|
| Name: | 2,3-Dimethylpentane | |
| Description: | ||
| Labels: | ||
| CAS: | 565-59-3 | |
| InChi Code: | InChI=1S/C7H16/c1-5-7(4)6(2)3/h6-7H,5H2,1-4H3 |
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 362.93 |
experimental value |
| 357.56 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 303.9 |
experimental value |
| 308.46 |
Eq13: Model for enthalphy of vaporization (Training set) |