| ID: | 617-84-5 | |
|---|---|---|
| Name: | N,N-Diethylformamide | |
| Description: | ||
| Labels: | ||
| CAS: | 617-84-5 | |
| InChi Code: | InChI=1S/C5H11NO/c1-3-6(4-2)5-7/h5H,3-4H2,1-2H3 |
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 450.65 |
experimental value |
| 423.62 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 371.622 |
experimental value |
| 386.48 |
Eq13: Model for enthalphy of vaporization (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID3020463 | US EPA CompTox Dashboard |