Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 67-64-1 | |
|---|---|---|
| Name: | Acetone | |
| Description: | ||
| Labels: | ||
| CAS: | 67-64-1 | |
| InChi Code: | InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 329.2 |
experimental value |
| 313.89 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 500.947 |
experimental value |
| 433.38 |
Eq13: Model for enthalphy of vaporization (Validation set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID8021482 | US EPA CompTox Dashboard |