Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 75-33-2 | |
|---|---|---|
| Name: | 2-Propanethiol | |
| Description: | ||
| Labels: | ||
| CAS: | 75-33-2 | |
| InChi Code: | InChI=1S/C3H8S/c1-3(2)4/h3-4H,1-2H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 325.75 |
experimental value |
| 351.68 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 366.37 |
experimental value |
| 385.52 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID1025481 | US EPA CompTox Dashboard |