Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 75-34-3 | |
|---|---|---|
| Name: | 1,1-Dichloroethane | |
| Description: | ||
| Labels: | ||
| CAS: | 75-34-3 | |
| InChi Code: | InChI=1S/C2H4Cl2/c1-2(3)4/h2H,1H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 330.45 |
experimental value |
| 329.74 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 291.53 |
experimental value |
| 278.46 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID1020437 | US EPA CompTox Dashboard |