Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 75-45-6 | |
|---|---|---|
| Name: | Chlorodifluoromethane | |
| Description: | ||
| Labels: | ||
| CAS: | 75-45-6 | |
| InChi Code: | InChI=1S/CHClF2/c2-1(3)4/h1H |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 232.35 |
experimental value |
| 231.9 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 233.8 |
experimental value |
| 255.44 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID6020301 | US EPA CompTox Dashboard |