Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 760-20-3 | |
|---|---|---|
| Name: | 3-Methyl-1-pentene | |
| Description: | ||
| Labels: | ||
| CAS: | 760-20-3 | |
| InChi Code: | InChI=1S/C6H12/c1-4-6(3)5-2/h4,6H,1,5H2,2-3H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 327.35 |
experimental value |
| 336.32 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 324.317 |
experimental value |
| 325.43 |
Eq13: Model for enthalphy of vaporization (Training set) |