Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 78-87-5 | |
|---|---|---|
| Name: | 1,2-Dichloropropane | |
| Description: | ||
| Labels: | ||
| CAS: | 78-87-5 | |
| InChi Code: | InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 369.55 |
experimental value |
| 369.63 |
Eq12: Model for normal boiling point (Validation set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 283.476 |
experimental value |
| 280.92 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID0020448 | US EPA CompTox Dashboard |