Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 79-01-6 | |
|---|---|---|
| Name: | Trichloroethylene | |
| Description: | CAS number corrected (from 79-01-06 to 79-01-6) | |
| Labels: | ||
| CAS: | 79-01-6 | |
| InChi Code: | InChI=1S/C2HCl3/c3-1-2(4)5/h1H |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 360.36 |
experimental value |
| 360.17 |
Eq12: Model for normal boiling point (Validation set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 240.706 |
experimental value |
| 234.27 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID0021383 | US EPA CompTox Dashboard |