Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 95-75-0 | |
|---|---|---|
| Name: | 1,2-Dichloro-4-methylbenzene | |
| Description: | ||
| Labels: | ||
| CAS: | 95-75-0 | |
| InChi Code: | InChI=1S/C7H6Cl2/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 482.05 |
experimental value |
| 493.61 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 270.962 |
experimental value |
| 270.56 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID2021814 | US EPA CompTox Dashboard |