Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 96-14-0 | |
|---|---|---|
| Name: | 3-Methylpentane | |
| Description: | ||
| Labels: | ||
| CAS: | 96-14-0 | |
| InChi Code: | InChI=1S/C6H14/c1-4-6(3)5-2/h6H,4-5H2,1-3H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 336.42 |
experimental value |
| 330.74 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 325.52 |
experimental value |
| 310.03 |
Eq13: Model for enthalphy of vaporization (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID8052647 | US EPA CompTox Dashboard |