Bagheri, M.; Borhani, T. N. G.; Zahedi, G. Estimation of flash point and autoignition temperature of organic sulfur chemicals. Energy Convers. Manage. 2012, 58, 185–196.
Compound
| ID: | 67-68-5 | |
|---|---|---|
| Name: | Dimethyl sulfoxide | |
| Description: | ||
| Labels: | Polyfunctional_C, H, O, S | |
| CAS: | 67-68-5 | |
| InChi Code: | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 |
Properties
FP: Flash point [K]
| Value | Source or prediction |
|---|---|
| 361 |
experimental value |
| 381 |
Eq6: PSO-MLR model for flash point (Training set) |
| 361 |
Tab5: FFNN model for flash point (Training set) |
AIT: Auto-Ignition Temperature [K]
| Value | Source or prediction |
|---|---|
| 488 |
experimental value |
| 501 |
Eq7: PSO-MLR model for auto-ignition temperature (Training set) |
| 490 |
Tab6: FFNN model for auto-ignition temperature (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID2021735 | US EPA CompTox Dashboard |