Bagheri, M.; Borhani, T. N. G.; Zahedi, G. Estimation of flash point and autoignition temperature of organic sulfur chemicals. Energy Convers. Manage. 2012, 58, 185–196.
Compound
| ID: | 75-33-2 | |
|---|---|---|
| Name: | Isopropyl mercaptan | |
| Description: | ||
| Labels: | Mercaptans | |
| CAS: | 75-33-2 | |
| InChi Code: | InChI=1S/C3H8S/c1-3(2)4/h3-4H,1-2H3 |
Properties
FP: Flash point [K]
| Value | Source or prediction |
|---|---|
| 239 |
experimental value |
| 262 |
Eq6: PSO-MLR model for flash point (Training set) |
| 255 |
Tab5: FFNN model for flash point (Training set) |
AIT: Auto-Ignition Temperature [K]
| Value | Source or prediction |
|---|---|
| 565 |
Eq7: PSO-MLR model for auto-ignition temperature (Prediction set) |
| 571 |
Tab6: FFNN model for auto-ignition temperature (Prediction set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID1025481 | US EPA CompTox Dashboard |