| ID: | 40 | |
|---|---|---|
| Name: | Decanoyl peroxide | |
| Description: | ||
| Labels: | Test | |
| CAS: | 762-12-9 | |
| InChi Code: | InChI=1S/C20H38O4/c1-3-5-7-9-11-13-15-17-19(21)23-24-20(22)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
SADT: Self-accelerating decomposition temperature [°C]
| Value | Source or prediction |
|---|---|
| 31 |
Bosch, C. M.; Velo, E.; Recasens, F. Safe storage temperature of peroxide initiators: prediction of self-accelerated decomposition temperature based on a runaway heuristics. Chemical Engineering Science 2001, 56, 1451-1457. https://doi.org/10.1016/s0009-2509(00)00370-5 |
| 36.86 |
Eq3: Model for self-accelerating decomposition temperature (Test set) |