| ID: | 9 | |
|---|---|---|
| Name: | Lauroyl peroxide | |
| Description: | ||
| Labels: | Training | |
| CAS: | 105-74-8 | |
| InChi Code: | InChI=1S/C24H46O4/c1-3-5-7-9-11-13-15-17-19-21-23(25)27-28-24(26)22-20-18-16-14-12-10-8-6-4-2/h3-22H2,1-2H3 |
SADT: Self-accelerating decomposition temperature [°C]
| Value | Source or prediction |
|---|---|
| 49 |
Sun, J.; Li, Y.; Hasegawa, K. A study of self-accelerating decomposition temperature (SADT) using reaction calorimetry. Journal of Loss Prevention in the Process Industries 2001, 14, 331-336. https://doi.org/10.1016/s0950-4230(01)00024-9 |
| 32.99 |
Eq3: Model for self-accelerating decomposition temperature (Training set) |
| Link | Resource description |
|---|---|
| DTXSID1059319 | US EPA CompTox Dashboard |