| ID: | 108 | |
|---|---|---|
| Name: | Biphenyl | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 92-52-4 | |
| InChi Code: | InChI=1/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 3.3 |
experimental value |
| 3.83 |
Eq1: Best externally predictive model (Validation set) |
| 3.8 |
Eq2: Full model, including all data (Training set) |
| 3.29 |
Tab2-9: Correlation with logKow (Validation set) |
| 3.32 |
Tab2-10: Correlation with logSw (Validation set) |
| 3.65 |
Tab2-11: logKow and aromaticity (Validation set) |
| 3.58 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID4020161 | US EPA CompTox Dashboard |