| ID: | 112 | |
|---|---|---|
| Name: | 2-Acetonaphthalene | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 93-08-3 | |
| InChi Code: | InChI=1/C12H10O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h2-8H,1H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2.9 |
experimental value |
| 2.6 |
Eq1: Best externally predictive model (Validation set) |
| 2.6 |
Eq2: Full model, including all data (Training set) |
| 2.51 |
Tab2-9: Correlation with logKow (Validation set) |
| 2.44 |
Tab2-10: Correlation with logSw (Validation set) |
| 2.81 |
Tab2-11: logKow and aromaticity (Validation set) |
| 2.66 |
Tab2-12: logSw and aromaticity (Validation set) |