| ID: | 141 | |
|---|---|---|
| Name: | Dichloran | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 99-30-9 | |
| InChi Code: | InChI=1/C6H4Cl2N2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 3.4 |
experimental value |
| 2.36 |
Eq1: Best externally predictive model (Validation set) |
| 2.5 |
Eq2: Full model, including all data (Training set) |
| 2.54 |
Tab2-9: Correlation with logKow (Validation set) |
| 3.31 |
Tab2-10: Correlation with logSw (Validation set) |
| 2.61 |
Tab2-11: logKow and aromaticity (Validation set) |
| 3.33 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID2020426 | US EPA CompTox Dashboard |