| ID: | 17 | |
|---|---|---|
| Name: | 7,12-Dimethylbenz[a]anthracene | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 57-97-6 | |
| InChi Code: | InChI=1/C20H16/c1-13-16-8-5-6-9-17(16)14(2)20-18(13)12-11-15-7-3-4-10-19(15)20/h3-12H,1-2H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 5.4 |
experimental value |
| 5.63 |
Eq1: Best externally predictive model (Validation set) |
| 5.53 |
Eq2: Full model, including all data (Training set) |
| 4.4 |
Tab2-9: Correlation with logKow (Validation set) |
| 4.45 |
Tab2-10: Correlation with logSw (Validation set) |
| 4.68 |
Tab2-11: logKow and aromaticity (Validation set) |
| 4.64 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID1020510 | US EPA CompTox Dashboard |