| ID: | 195 | |
|---|---|---|
| Name: | 3,5-Dimethylphenol | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 108-68-9 | |
| InChi Code: | InChI=1/C8H10O/c1-6-3-7(2)5-8(9)4-6/h3-5,9H,1-2H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2.8 |
experimental value |
| 1.79 |
Eq1: Best externally predictive model (Validation set) |
| 1.82 |
Eq2: Full model, including all data (Training set) |
| 2.26 |
Tab2-9: Correlation with logKow (Validation set) |
| 1.75 |
Tab2-10: Correlation with logSw (Validation set) |
| 2.48 |
Tab2-11: logKow and aromaticity (Validation set) |
| 1.94 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID1025148 | US EPA CompTox Dashboard |