| ID: | 196 | |
|---|---|---|
| Name: | 1,3,5-Trichlorobenzene | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 108-70-3 | |
| InChi Code: | InChI=1/C6H3Cl3/c7-4-1-5(8)3-6(9)2-4/h1-3H |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2.9 |
experimental value |
| 2.9 |
Eq1: Best externally predictive model (Validation set) |
| 2.97 |
Eq2: Full model, including all data (Training set) |
| 3.4 |
Tab2-9: Correlation with logKow (Validation set) |
| 2.96 |
Tab2-10: Correlation with logSw (Validation set) |
| 3.55 |
Tab2-11: logKow and aromaticity (Validation set) |
| 3.09 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID8026195 | US EPA CompTox Dashboard |