| ID: | 226 | |
|---|---|---|
| Name: | Catechol | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 120-80-9 | |
| InChi Code: | InChI=1/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2.1 |
experimental value |
| 1.42 |
Eq1: Best externally predictive model (Validation set) |
| 1.53 |
Eq2: Full model, including all data (Training set) |
| 1.4 |
Tab2-9: Correlation with logKow (Validation set) |
| 0.66 |
Tab2-10: Correlation with logSw (Validation set) |
| 1.73 |
Tab2-11: logKow and aromaticity (Validation set) |
| 0.95 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID3020257 | US EPA CompTox Dashboard |