| ID: | 269 | |
|---|---|---|
| Name: | Benzo[g,h,i]perylene | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 191-24-2 | |
| InChi Code: | InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 5.4 |
experimental value |
| 6.12 |
Eq1: Best externally predictive model (Validation set) |
| 6.03 |
Eq2: Full model, including all data (Training set) |
| 4.91 |
Tab2-9: Correlation with logKow (Validation set) |
| 5.76 |
Tab2-10: Correlation with logSw (Validation set) |
| 5.23 |
Tab2-11: logKow and aromaticity (Validation set) |
| 5.94 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID5023908 | US EPA CompTox Dashboard |