| ID: | 279 | |
|---|---|---|
| Name: | Dibenz[a,j]anthracene | |
| Description: | ||
| Labels: | Training | |
| CAS: | 224-41-9 | |
| InChi Code: | InChI=1/C22H14/c1-3-7-19-15(5-1)9-11-17-13-18-12-10-16-6-2-4-8-20(16)22(18)14-21(17)19/h1-14H |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 6 |
experimental value |
| 6.05 |
Eq1: Best externally predictive model (Training set) |
| 5.94 |
Eq2: Full model, including all data (Training set) |
| 4.79 |
Tab2-9: Correlation with logKow (Training set) |
| 5.38 |
Tab2-10: Correlation with logSw (Training set) |
| 5.11 |
Tab2-11: logKow and aromaticity (Training set) |
| 5.59 |
Tab2-12: logSw and aromaticity (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8074811 | US EPA CompTox Dashboard |