| ID: | 343 | |
|---|---|---|
| Name: | 3-Bromoacetanilide | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 621-38-5 | |
| InChi Code: | InChI=1/C8H8BrNO/c1-6(11)10-8-4-2-3-7(9)5-8/h2-5H,1H3,(H,10,11)/f/h10H |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2 |
experimental value |
| 2.07 |
Eq1: Best externally predictive model (Validation set) |
| 2.16 |
Eq2: Full model, including all data (Training set) |
| 2.25 |
Tab2-9: Correlation with logKow (Validation set) |
| 2.35 |
Tab2-10: Correlation with logSw (Validation set) |
| 2.37 |
Tab2-11: logKow and aromaticity (Validation set) |
| 2.44 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID50211149 | US EPA CompTox Dashboard |