| ID: | 354 | |
|---|---|---|
| Name: | 2-Fluorophenylurea | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 656-31-5 | |
| InChi Code: | InChI=1/C7H7FN2O/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11)/f/h10H,9H2 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 1.3 |
experimental value |
| 1.13 |
Eq1: Best externally predictive model (Validation set) |
| 1.29 |
Eq2: Full model, including all data (Training set) |
| 1.36 |
Tab2-9: Correlation with logKow (Validation set) |
| 1.51 |
Tab2-10: Correlation with logSw (Validation set) |
| 1.53 |
Tab2-11: logKow and aromaticity (Validation set) |
| 1.65 |
Tab2-12: logSw and aromaticity (Validation set) |