| ID: | 363 | |
|---|---|---|
| Name: | EPTC | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 759-94-4 | |
| InChi Code: | InChI=1/C9H19NOS/c1-4-7-10(8-5-2)9(11)12-6-3/h4-8H2,1-3H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2.4 |
experimental value |
| 1.75 |
Eq1: Best externally predictive model (Validation set) |
| 1.77 |
Eq2: Full model, including all data (Training set) |
| 2.8 |
Tab2-9: Correlation with logKow (Validation set) |
| 2.36 |
Tab2-10: Correlation with logSw (Validation set) |
| 2.46 |
Tab2-11: logKow and aromaticity (Validation set) |
| 2.14 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID1024091 | US EPA CompTox Dashboard |