| ID: | 450 | |
|---|---|---|
| Name: | Oxythioquinox | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 2439-01-2 | |
| InChi Code: | InChI=1/C10H6N2OS2/c1-5-2-3-6-7(4-5)12-9-8(11-6)14-10(13)15-9/h2-4H,1H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 3.4 |
experimental value |
| 2.03 |
Eq1: Best externally predictive model (Validation set) |
| 2.81 |
Eq2: Full model, including all data (Training set) |
| 3.15 |
Tab2-9: Correlation with logKow (Validation set) |
| 3.78 |
Tab2-10: Correlation with logSw (Validation set) |
| 3.3 |
Tab2-11: logKow and aromaticity (Validation set) |
| 3.86 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID2032342 | US EPA CompTox Dashboard |