| ID: | 495 | |
|---|---|---|
| Name: | Chloramben methyl | |
| Description: | ||
| Labels: | Training | |
| CAS: | 7286-84-2 | |
| InChi Code: | InChI=1/C8H7Cl2NO2/c1-13-8(12)5-2-4(9)3-6(11)7(5)10/h2-3H,11H2,1H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2.7 |
experimental value |
| 2.19 |
Eq1: Best externally predictive model (Training set) |
| 2.32 |
Eq2: Full model, including all data (Training set) |
| 2.38 |
Tab2-9: Correlation with logKow (Training set) |
| 2.63 |
Tab2-10: Correlation with logSw (Training set) |
| 2.43 |
Tab2-11: logKow and aromaticity (Training set) |
| 2.66 |
Tab2-12: logSw and aromaticity (Training set) |
| Link | Resource description |
|---|---|
| DTXSID1041762 | US EPA CompTox Dashboard |