| ID: | 517 | |
|---|---|---|
| Name: | Chlorotoluron | |
| Description: | ||
| Labels: | Training | |
| CAS: | 15545-48-9 | |
| InChi Code: | InChI=1/C10H13ClN2O/c1-7-4-5-8(6-9(7)11)12-10(14)13(2)3/h4-6H,1-3H3,(H,12,14)/f/h12H |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2 |
experimental value |
| 2.21 |
Eq1: Best externally predictive model (Training set) |
| 2.28 |
Eq2: Full model, including all data (Training set) |
| 2.3 |
Tab2-9: Correlation with logKow (Training set) |
| 2.77 |
Tab2-10: Correlation with logSw (Training set) |
| 2.33 |
Tab2-11: logKow and aromaticity (Training set) |
| 2.77 |
Tab2-12: logSw and aromaticity (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8052853 | US EPA CompTox Dashboard |