| ID: | 523 | |
|---|---|---|
| Name: | Methabenzthiazuron | |
| Description: | ||
| Labels: | Training | |
| CAS: | 18691-97-9 | |
| InChi Code: | InChI=1/C10H11N3OS/c1-11-9(14)13(2)10-12-7-5-3-4-6-8(7)15-10/h3-6H,1-2H3,(H,11,14)/f/h11H |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2.8 |
experimental value |
| 2.15 |
Eq1: Best externally predictive model (Training set) |
| 2.27 |
Eq2: Full model, including all data (Training set) |
| 2.02 |
Tab2-9: Correlation with logKow (Training set) |
| 2.8 |
Tab2-10: Correlation with logSw (Training set) |
| 2.22 |
Tab2-11: logKow and aromaticity (Training set) |
| 2.92 |
Tab2-12: logSw and aromaticity (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0037570 | US EPA CompTox Dashboard |