| ID: | 545 | |
|---|---|---|
| Name: | 3-Chloro-4-methoxyphenylurea | |
| Description: | ||
| Labels: | Training | |
| CAS: | 25277-05-8 | |
| InChi Code: | InChI=1/C8H9ClN2O2/c1-13-7-3-2-5(4-6(7)9)11-8(10)12/h2-4H,1H3,(H3,10,11,12)/f/h11H,10H2 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2 |
experimental value |
| 1.99 |
Eq1: Best externally predictive model (Training set) |
| 2.12 |
Eq2: Full model, including all data (Training set) |
| 1.65 |
Tab2-9: Correlation with logKow (Training set) |
| 1.86 |
Tab2-10: Correlation with logSw (Training set) |
| 1.75 |
Tab2-11: logKow and aromaticity (Training set) |
| 1.93 |
Tab2-12: logSw and aromaticity (Training set) |