| ID: | 562 | |
|---|---|---|
| Name: | 2,4-DB butoxyethyl ester | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 32357-46-3 | |
| InChi Code: | InChI=1/C16H22Cl2O4/c1-2-3-8-20-10-11-22-16(19)5-4-9-21-15-7-6-13(17)12-14(15)18/h6-7,12H,2-5,8-11H2,1H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2.7 |
experimental value |
| 3.48 |
Eq1: Best externally predictive model (Validation set) |
| 3.51 |
Eq2: Full model, including all data (Training set) |
| 3.95 |
Tab2-9: Correlation with logKow (Validation set) |
| 4.08 |
Tab2-10: Correlation with logSw (Validation set) |
| 3.76 |
Tab2-11: logKow and aromaticity (Validation set) |
| 3.93 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID5041354 | US EPA CompTox Dashboard |