| ID: | 569 | |
|---|---|---|
| Name: | Acetochlor | |
| Description: | ||
| Labels: | Training | |
| CAS: | 34256-82-1 | |
| InChi Code: | InChI=1/C14H20ClNO2/c1-4-12-8-6-7-11(3)14(12)16(10-18-5-2)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2.2 |
experimental value |
| 2.82 |
Eq1: Best externally predictive model (Training set) |
| 2.82 |
Eq2: Full model, including all data (Training set) |
| 2.29 |
Tab2-9: Correlation with logKow (Training set) |
| 2.49 |
Tab2-10: Correlation with logSw (Training set) |
| 2.24 |
Tab2-11: logKow and aromaticity (Training set) |
| 2.45 |
Tab2-12: logSw and aromaticity (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8023848 | US EPA CompTox Dashboard |