| ID: | 585 | |
|---|---|---|
| Name: | Pendimethalin | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 40487-42-1 | |
| InChi Code: | InChI=1/C13H19N3O4/c1-5-10(6-2)14-12-11(15(17)18)7-8(3)9(4)13(12)16(19)20/h7,10,14H,5-6H2,1-4H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 3 |
experimental value |
| 2.85 |
Eq1: Best externally predictive model (Validation set) |
| 2.92 |
Eq2: Full model, including all data (Training set) |
| 4.01 |
Tab2-9: Correlation with logKow (Validation set) |
| 4.09 |
Tab2-10: Correlation with logSw (Validation set) |
| 3.84 |
Tab2-11: logKow and aromaticity (Validation set) |
| 3.95 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID7024245 | US EPA CompTox Dashboard |