| ID: | 599 | |
|---|---|---|
| Name: | Permethrin | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 52645-53-1 | |
| InChi Code: | InChI=1/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3/t17-,19-/m0/s1 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 4 |
experimental value |
| 4.36 |
Eq1: Best externally predictive model (Validation set) |
| 4.35 |
Eq2: Full model, including all data (Training set) |
| 4.83 |
Tab2-9: Correlation with logKow (Validation set) |
| 5.01 |
Tab2-10: Correlation with logSw (Validation set) |
| 4.71 |
Tab2-11: logKow and aromaticity (Validation set) |
| 4.89 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID8022292 | US EPA CompTox Dashboard |