| ID: | 626 | |
|---|---|---|
| Name: | Sethoxydim | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 74051-80-2 | |
| InChi Code: | InChI=1S/C17H29NO3S/c1-5-8-14(18-21-6-2)17-15(19)10-13(11-16(17)20)9-12(4)22-7-3/h12-13,19H,5-11H2,1-4H3/b18-14+ |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2 |
experimental value |
| 3.03 |
Eq1: Best externally predictive model (Validation set) |
| 3.05 |
Eq2: Full model, including all data (Training set) |
| 3.52 |
Tab2-9: Correlation with logKow (Validation set) |
| 3.01 |
Tab2-10: Correlation with logSw (Validation set) |
| 3.14 |
Tab2-11: logKow and aromaticity (Validation set) |
| 2.75 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID9024304 | US EPA CompTox Dashboard |