| ID: | 65 | |
|---|---|---|
| Name: | Trichloroethene | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 79-01-6 | |
| InChi Code: | InChI=1/C2HCl3/c3-1-2(4)5/h1H |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 2 |
experimental value |
| 1.81 |
Eq1: Best externally predictive model (Validation set) |
| 1.95 |
Eq2: Full model, including all data (Training set) |
| 2.42 |
Tab2-9: Correlation with logKow (Validation set) |
| 2.07 |
Tab2-10: Correlation with logSw (Validation set) |
| 2.11 |
Tab2-11: logKow and aromaticity (Validation set) |
| 1.85 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID0021383 | US EPA CompTox Dashboard |