| ID: | 81 | |
|---|---|---|
| Name: | n-Butyl benzyl phthalate | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 85-68-7 | |
| InChi Code: | InChI=1/C19H20O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-12H,2-3,13-14H2,1H3 |
logKoc: logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 3.7 |
experimental value |
| 3.4 |
Eq1: Best externally predictive model (Validation set) |
| 3.41 |
Eq2: Full model, including all data (Training set) |
| 3.85 |
Tab2-9: Correlation with logKow (Validation set) |
| 3.54 |
Tab2-10: Correlation with logSw (Validation set) |
| 3.84 |
Tab2-11: logKow and aromaticity (Validation set) |
| 3.55 |
Tab2-12: logSw and aromaticity (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID3020205 | US EPA CompTox Dashboard |