Richard, A.M.; Hunter, E.S. Quantitative structure-activity relationships for the developmental toxicity of haloacetic acids in mammalian whole embryo culture. Teratology 1996, 53, 352-360.
Compound
| ID: | DBA | |
|---|---|---|
| Name: | Dibromoacetic acid | |
| Description: | pKA calculated with ASTER software | |
| Labels: | ||
| CAS: | 631-64-1 | |
| InChi Code: | InChI=1S/C2H2Br2O2/c3-1(4)2(5)6/h1H,(H,5,6) |
Properties
pBCm: Benchmark concentration for 5% increase in embryos with neural tube defects as log(1/BCm)
| Value | Source or prediction |
|---|---|
| 3.79 |
experimental value |
| 3.6400176 |
QSAR2: Developmental toxicity of haloacetic acids (Training set) |