Richard, A.M.; Hunter, E.S. Quantitative structure-activity relationships for the developmental toxicity of haloacetic acids in mammalian whole embryo culture. Teratology 1996, 53, 352-360.
Compound
| ID: | MCA | |
|---|---|---|
| Name: | Monochloroacetic acid | |
| Description: | ||
| Labels: | ||
| CAS: | 79-11-8 | |
| InChi Code: | InChI=1S/C2H3ClO2/c3-1-2(4)5/h1H2,(H,4,5) |
Properties
pBCm: Benchmark concentration for 5% increase in embryos with neural tube defects as log(1/BCm)
| Value | Source or prediction |
|---|---|
| 4.039 |
experimental value |
| 4.3496480 |
QSAR2: Developmental toxicity of haloacetic acids (Training set) |