| ID: | 11 | |
|---|---|---|
| Name: | Rose Bengal | |
| Description: | Corrected CAS number from incorrect 1121-48-5 in the article to 11121-48-5 Most likely used by authors in ionized form for descriptor calculation. | |
| Labels: | ||
| CAS: | 11121-48-5 | |
| InChi Code: | InChI=1S/C20H4Cl4I4O5.2K/c21-10-8(9(20(31)32)11(22)13(24)12(10)23)7-3-1-5(25)16(29)14(27)18(3)33-19-4(7)2-6(26)17(30)15(19)28;;/h1-2,29H,(H,31,32);;/q;2*+1/p-2 |
3T3_NRU_Phototoxicity: Neural red uptake phototoxicity: P - phototoxic, nP - non-phototoxic
| Value | Source or prediction |
|---|---|
| P |
experimental value |
| P |
Phototoxicity_window: Acute phototoxicity classifier based on HOMO-LUMO energy gap (EGAP) (Training set) |